C29H25N3O — CID 132603553
2-[[4-[(E)-2-[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-3-methoxyphenyl]ethenyl]phenyl]methylidene]propanedinitrile (PubChem CID 132603553) has the molecular formula C29H25N3O and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-[[4-[(E)-2-[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-3-methoxyphenyl]ethenyl]phenyl]methylidene]propanedinitrile.
| Compound Name | 2-[[4-[(E)-2-[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-3-methoxyphenyl]ethenyl]phenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 132603553 |
| Molecular Formula | C29H25N3O |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 2-[[4-[(E)-2-[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-3-methoxyphenyl]ethenyl]phenyl]methylidene]propanedinitrile |
| SMILES | COc1cc(/C=C/c2ccc(C=C(C#N)C#N)cc2)ccc1/C=C/c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C29H25N3O/c1-32(2)28-16-12-23(13-17-28)10-14-27-15-11-25(19-29(27)33-3)9-6-22-4-7-24(8-5-22)18-26(20-30)21-31/h4-19H,1-3H3/b9-6+,14-10+ |
| InChIKey | LTPKBKAHQGMINZ-UYQSWCAZSA-N |
| XLogP | 6.53 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|