About 4-[(Z)-2-fluoro-3,3-dimethyl-1-phenylbut-1-enyl]benzaldehyde
4-[(Z)-2-fluoro-3,3-dimethyl-1-phenylbut-1-enyl]benzaldehyde (PubChem CID 102283084) has the molecular formula C19H19FO
and a molecular weight of 282.36 g/mol. Its IUPAC name is 4-[(Z)-2-fluoro-3,3-dimethyl-1-phenylbut-1-enyl]benzaldehyde.
Molecular Properties
| Compound Name | 4-[(Z)-2-fluoro-3,3-dimethyl-1-phenylbut-1-enyl]benzaldehyde |
| PubChem CID | 102283084 |
| Molecular Formula | C19H19FO |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 4-[(Z)-2-fluoro-3,3-dimethyl-1-phenylbut-1-enyl]benzaldehyde |
| SMILES | CC(C)(C)/C(F)=C(\c1ccccc1)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C19H19FO/c1-19(2,3)18(20)17(15-7-5-4-6-8-15)16-11-9-14(13-21)10-12-16/h4-13H,1-3H3/b18-17- |
| InChIKey | RYASMJJLAFOZTA-ZCXUNETKSA-N |
| XLogP | 5.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-[(Z)-2-fluoro-3,3-dimethyl-1-phenylbut-1-enyl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-2-fluoro-3,3-dimethyl-1-phenylbut-1-enyl]benzaldehyde?
The IUPAC name of 4-[(Z)-2-fluoro-3,3-dimethyl-1-phenylbut-1-enyl]benzaldehyde (CID 102283084) is 4-[(Z)-2-fluoro-3,3-dimethyl-1-phenylbut-1-enyl]benzaldehyde.
What is the SMILES notation for 4-[(Z)-2-fluoro-3,3-dimethyl-1-phenylbut-1-enyl]benzaldehyde?
The canonical SMILES for 4-[(Z)-2-fluoro-3,3-dimethyl-1-phenylbut-1-enyl]benzaldehyde is CC(C)(C)/C(F)=C(\c1ccccc1)c1ccc(C=O)cc1.
What is the InChIKey of 4-[(Z)-2-fluoro-3,3-dimethyl-1-phenylbut-1-enyl]benzaldehyde?
The InChIKey is RYASMJJLAFOZTA-ZCXUNETKSA-N. The full InChI is InChI=1S/C19H19FO/c1-19(2,3)18(20)17(15-7-5-4-6-8-15)16-11-9-14(13-21)10-12-16/h4-13H,1-3H3/b18-17-.
What are the key properties of 4-[(Z)-2-fluoro-3,3-dimethyl-1-phenylbut-1-enyl]benzaldehyde?
4-[(Z)-2-fluoro-3,3-dimethyl-1-phenylbut-1-enyl]benzaldehyde has a molecular weight of 282.36 g/mol, XLogP of 5.27, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-2-fluoro-3,3-dimethyl-1-phenylbut-1-enyl]benzaldehyde is sourced from PubChem (CID 102283084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).