C32H27N3O — CID 122383227
2-[3-[(E)-2-[4-(N-(4-formylphenyl)anilino)phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile (PubChem CID 122383227) has the molecular formula C32H27N3O and a molecular weight of 469.59 g/mol. Its IUPAC name is 2-[3-[(E)-2-[4-(N-(4-formylphenyl)anilino)phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile.
| Compound Name | 2-[3-[(E)-2-[4-(N-(4-formylphenyl)anilino)phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 122383227 |
| Molecular Formula | C32H27N3O |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 2-[3-[(E)-2-[4-(N-(4-formylphenyl)anilino)phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile |
| SMILES | CC1(C)CC(/C=C/c2ccc(N(c3ccccc3)c3ccc(C=O)cc3)cc2)=CC(=C(C#N)C#N)C1 |
| InChI | InChI=1S/C32H27N3O/c1-32(2)19-26(18-27(20-32)28(21-33)22-34)9-8-24-10-14-30(15-11-24)35(29-6-4-3-5-7-29)31-16-12-25(23-36)13-17-31/h3-18,23H,19-20H2,1-2H3/b9-8+ |
| InChIKey | ZLCWEGAEKSAXDL-CMDGGOBGSA-N |
| XLogP | 8.07 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|