C50H40N2O2 — CID 44557812
1-[4-acetyl-2,5-bis[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]ethanone (PubChem CID 44557812) has the molecular formula C50H40N2O2 and a molecular weight of 700.88 g/mol. Its IUPAC name is 1-[4-acetyl-2,5-bis[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]ethanone.
| Compound Name | 1-[4-acetyl-2,5-bis[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]ethanone |
|---|---|
| PubChem CID | 44557812 |
| Molecular Formula | C50H40N2O2 |
| Molecular Weight | 700.88 g/mol |
| Exact Mass | 700.31 |
| IUPAC Name | 1-[4-acetyl-2,5-bis[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]ethanone |
| SMILES | CC(=O)c1cc(/C=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)c(C(C)=O)cc1/C=C/c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C50H40N2O2/c1-37(53)49-35-42(30-24-40-27-33-48(34-28-40)52(45-19-11-5-12-20-45)46-21-13-6-14-22-46)50(38(2)54)36-41(49)29-23-39-25-31-47(32-26-39)51(43-15-7-3-8-16-43)44-17-9-4-10-18-44/h3-36H,1-2H3/b29-23+,30-24+ |
| InChIKey | BCBCZKHSPZUVOV-HCTXVGCHSA-N |
| XLogP | 13.37 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.88 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|