C48H36N2O2 — CID 44557741
2,5-bis[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]terephthalaldehyde (PubChem CID 44557741) has the molecular formula C48H36N2O2 and a molecular weight of 672.83 g/mol. Its IUPAC name is 2,5-bis[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]terephthalaldehyde.
| Compound Name | 2,5-bis[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]terephthalaldehyde |
|---|---|
| PubChem CID | 44557741 |
| Molecular Formula | C48H36N2O2 |
| Molecular Weight | 672.83 g/mol |
| Exact Mass | 672.28 |
| IUPAC Name | 2,5-bis[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]terephthalaldehyde |
| SMILES | O=Cc1cc(/C=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)c(C=O)cc1/C=C/c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C48H36N2O2/c51-35-41-34-40(28-22-38-25-31-48(32-26-38)50(45-17-9-3-10-18-45)46-19-11-4-12-20-46)42(36-52)33-39(41)27-21-37-23-29-47(30-24-37)49(43-13-5-1-6-14-43)44-15-7-2-8-16-44/h1-36H/b27-21+,28-22+ |
| InChIKey | QJJKOEJSHDAJBV-GPAWKIAZSA-N |
| XLogP | 12.59 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.83 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|