C38H35NO4 — CID 102332220
2-[6-[4-[4-(N-phenylanilino)phenyl]phenoxy]hexoxy]terephthalaldehyde (PubChem CID 102332220) has the molecular formula C38H35NO4 and a molecular weight of 569.70 g/mol. Its IUPAC name is 2-[6-[4-[4-(N-phenylanilino)phenyl]phenoxy]hexoxy]terephthalaldehyde.
| Compound Name | 2-[6-[4-[4-(N-phenylanilino)phenyl]phenoxy]hexoxy]terephthalaldehyde |
|---|---|
| PubChem CID | 102332220 |
| Molecular Formula | C38H35NO4 |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | 2-[6-[4-[4-(N-phenylanilino)phenyl]phenoxy]hexoxy]terephthalaldehyde |
| SMILES | O=Cc1ccc(C=O)c(OCCCCCCOc2ccc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc2)c1 |
| InChI | InChI=1S/C38H35NO4/c40-28-30-15-16-33(29-41)38(27-30)43-26-10-2-1-9-25-42-37-23-19-32(20-24-37)31-17-21-36(22-18-31)39(34-11-5-3-6-12-34)35-13-7-4-8-14-35/h3-8,11-24,27-29H,1-2,9-10,25-26H2 |
| InChIKey | OVWMFSIJLXTPTG-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|