C27H23NO3 — CID 20580224
4-[4-(N-[4-(2-hydroxyethoxy)phenyl]anilino)phenyl]benzaldehyde (PubChem CID 20580224) has the molecular formula C27H23NO3 and a molecular weight of 409.49 g/mol. Its IUPAC name is 4-[4-(N-[4-(2-hydroxyethoxy)phenyl]anilino)phenyl]benzaldehyde.
| Compound Name | 4-[4-(N-[4-(2-hydroxyethoxy)phenyl]anilino)phenyl]benzaldehyde |
|---|---|
| PubChem CID | 20580224 |
| Molecular Formula | C27H23NO3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 4-[4-(N-[4-(2-hydroxyethoxy)phenyl]anilino)phenyl]benzaldehyde |
| SMILES | O=Cc1ccc(-c2ccc(N(c3ccccc3)c3ccc(OCCO)cc3)cc2)cc1 |
| InChI | InChI=1S/C27H23NO3/c29-18-19-31-27-16-14-26(15-17-27)28(24-4-2-1-3-5-24)25-12-10-23(11-13-25)22-8-6-21(20-30)7-9-22/h1-17,20,29H,18-19H2 |
| InChIKey | CUOSATCZUGJOKP-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|