C35H28O3 — CID 141459269
4-[4-[2-[4-(2-hydroxyethoxy)phenyl]-1,2-diphenylethenyl]phenyl]benzaldehyde (PubChem CID 141459269) has the molecular formula C35H28O3 and a molecular weight of 496.61 g/mol. Its IUPAC name is 4-[4-[2-[4-(2-hydroxyethoxy)phenyl]-1,2-diphenylethenyl]phenyl]benzaldehyde.
| Compound Name | 4-[4-[2-[4-(2-hydroxyethoxy)phenyl]-1,2-diphenylethenyl]phenyl]benzaldehyde |
|---|---|
| PubChem CID | 141459269 |
| Molecular Formula | C35H28O3 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 4-[4-[2-[4-(2-hydroxyethoxy)phenyl]-1,2-diphenylethenyl]phenyl]benzaldehyde |
| SMILES | O=Cc1ccc(-c2ccc(C(=C(c3ccccc3)c3ccc(OCCO)cc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C35H28O3/c36-23-24-38-33-21-19-32(20-22-33)35(30-9-5-2-6-10-30)34(29-7-3-1-4-8-29)31-17-15-28(16-18-31)27-13-11-26(25-37)12-14-27/h1-22,25,36H,23-24H2 |
| InChIKey | OYYFPVYFNHLFTE-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|