C34H35NO5 — CID 25192213
6-[2,6-dimethoxy-4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenoxy]hexanoic acid (PubChem CID 25192213) has the molecular formula C34H35NO5 and a molecular weight of 537.66 g/mol. Its IUPAC name is 6-[2,6-dimethoxy-4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2,6-dimethoxy-4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 25192213 |
| Molecular Formula | C34H35NO5 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | 6-[2,6-dimethoxy-4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenoxy]hexanoic acid |
| SMILES | COc1cc(/C=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc(OC)c1OCCCCCC(=O)O |
| InChI | InChI=1S/C34H35NO5/c1-38-31-24-27(25-32(39-2)34(31)40-23-11-5-10-16-33(36)37)18-17-26-19-21-30(22-20-26)35(28-12-6-3-7-13-28)29-14-8-4-9-15-29/h3-4,6-9,12-15,17-22,24-25H,5,10-11,16,23H2,1-2H3,(H,36,37)/b18-17+ |
| InChIKey | ISGIBPHUKMTAHL-ISLYRVAYSA-N |
| XLogP | 8.37 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|