C21H25NO5 — CID 140987432
6-[4-[(2-methoxybenzoyl)-methylamino]phenoxy]hexanoic acid (PubChem CID 140987432) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is 6-[4-[(2-methoxybenzoyl)-methylamino]phenoxy]hexanoic acid.
| Compound Name | 6-[4-[(2-methoxybenzoyl)-methylamino]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 140987432 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 6-[4-[(2-methoxybenzoyl)-methylamino]phenoxy]hexanoic acid |
| SMILES | COc1ccccc1C(=O)N(C)c1ccc(OCCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C21H25NO5/c1-22(21(25)18-8-5-6-9-19(18)26-2)16-11-13-17(14-12-16)27-15-7-3-4-10-20(23)24/h5-6,8-9,11-14H,3-4,7,10,15H2,1-2H3,(H,23,24) |
| InChIKey | YALAFZWGPBPXSY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|