C20H30O5 — CID 10360531
(E)-6-(4-hexoxy-3,5-dimethoxyphenyl)hex-5-enoic acid (PubChem CID 10360531) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (E)-6-(4-hexoxy-3,5-dimethoxyphenyl)hex-5-enoic acid.
| Compound Name | (E)-6-(4-hexoxy-3,5-dimethoxyphenyl)hex-5-enoic acid |
|---|---|
| PubChem CID | 10360531 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (E)-6-(4-hexoxy-3,5-dimethoxyphenyl)hex-5-enoic acid |
| SMILES | CCCCCCOc1c(OC)cc(/C=C/CCCC(=O)O)cc1OC |
| InChI | InChI=1S/C20H30O5/c1-4-5-6-10-13-25-20-17(23-2)14-16(15-18(20)24-3)11-8-7-9-12-19(21)22/h8,11,14-15H,4-7,9-10,12-13H2,1-3H3,(H,21,22)/b11-8+ |
| InChIKey | LJAODMQJKACBCM-DHZHZOJOSA-N |
| XLogP | 4.93 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|