C20H24ClF6N2O2PS — CID 18987035
2,5-dibutoxy-4-(2-chlorophenyl)sulfanylbenzenediazonium hexafluorophosphate (PubChem CID 18987035) has the molecular formula C20H24ClF6N2O2PS and a molecular weight of 536.91 g/mol. Its IUPAC name is 2,5-dibutoxy-4-(2-chlorophenyl)sulfanylbenzenediazonium hexafluorophosphate.
| Compound Name | 2,5-dibutoxy-4-(2-chlorophenyl)sulfanylbenzenediazonium hexafluorophosphate |
|---|---|
| PubChem CID | 18987035 |
| Molecular Formula | C20H24ClF6N2O2PS |
| Molecular Weight | 536.91 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | 2,5-dibutoxy-4-(2-chlorophenyl)sulfanylbenzenediazonium hexafluorophosphate |
| SMILES | CCCCOc1cc(Sc2ccccc2Cl)c(OCCCC)cc1[N+]#N.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C20H24ClN2O2S.F6P/c1-3-5-11-24-17-14-20(26-19-10-8-7-9-15(19)21)18(13-16(17)23-22)25-12-6-4-2;1-7(2,3,4,5)6/h7-10,13-14H,3-6,11-12H2,1-2H3;/q+1;-1 |
| InChIKey | PBMLSKJQVZOGLH-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.91 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|