C18H28ClN3O7 — CID 71382500
2,5-dibutoxy-4-morpholin-4-ylbenzenediazonium perchlorate (PubChem CID 71382500) has the molecular formula C18H28ClN3O7 and a molecular weight of 433.89 g/mol. Its IUPAC name is 2,5-dibutoxy-4-morpholin-4-ylbenzenediazonium perchlorate.
| Compound Name | 2,5-dibutoxy-4-morpholin-4-ylbenzenediazonium perchlorate |
|---|---|
| PubChem CID | 71382500 |
| Molecular Formula | C18H28ClN3O7 |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 2,5-dibutoxy-4-morpholin-4-ylbenzenediazonium perchlorate |
| SMILES | CCCCOc1cc(N2CCOCC2)c(OCCCC)cc1[N+]#N.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C18H28N3O3.ClHO4/c1-3-5-9-23-17-14-16(21-7-11-22-12-8-21)18(13-15(17)20-19)24-10-6-4-2;2-1(3,4)5/h13-14H,3-12H2,1-2H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | LVNVSCSWCZONQA-UHFFFAOYSA-M |
| XLogP | -0.39 |
| TPSA | 151.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|