C18H30N2O7S-2 — CID 6366686
2,5-dibutoxy-4-morpholin-4-ylaniline sulfate (PubChem CID 6366686) has the molecular formula C18H30N2O7S-2 and a molecular weight of 418.51 g/mol. Its IUPAC name is 2,5-dibutoxy-4-morpholin-4-ylaniline sulfate.
| Compound Name | 2,5-dibutoxy-4-morpholin-4-ylaniline sulfate |
|---|---|
| PubChem CID | 6366686 |
| Molecular Formula | C18H30N2O7S-2 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 2,5-dibutoxy-4-morpholin-4-ylaniline sulfate |
| SMILES | CCCCOc1cc(N2CCOCC2)c(OCCCC)cc1N.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C18H30N2O3.H2O4S/c1-3-5-9-22-17-14-16(20-7-11-21-12-8-20)18(13-15(17)19)23-10-6-4-2;1-5(2,3)4/h13-14H,3-12,19H2,1-2H3;(H2,1,2,3,4)/p-2 |
| InChIKey | ONLYZWBOMYPZPY-UHFFFAOYSA-L |
| XLogP | 2.13 |
| TPSA | 137.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|