C18H30N2O3 — CID 154107073
2,5-di(butan-2-yloxy)-4-morpholin-4-ylaniline (PubChem CID 154107073) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is 2,5-di(butan-2-yloxy)-4-morpholin-4-ylaniline.
| Compound Name | 2,5-di(butan-2-yloxy)-4-morpholin-4-ylaniline |
|---|---|
| PubChem CID | 154107073 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 2,5-di(butan-2-yloxy)-4-morpholin-4-ylaniline |
| SMILES | CCC(C)Oc1cc(N2CCOCC2)c(OC(C)CC)cc1N |
| InChI | InChI=1S/C18H30N2O3/c1-5-13(3)22-17-12-16(20-7-9-21-10-8-20)18(11-15(17)19)23-14(4)6-2/h11-14H,5-10,19H2,1-4H3 |
| InChIKey | XVBITWMHJUJTPB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|