C12H17FN2O2 — CID 63598726
5-fluoro-4-methoxy-2-(1,4-oxazepan-4-yl)aniline (PubChem CID 63598726) has the molecular formula C12H17FN2O2 and a molecular weight of 240.28 g/mol. Its IUPAC name is 5-fluoro-4-methoxy-2-(1,4-oxazepan-4-yl)aniline.
| Compound Name | 5-fluoro-4-methoxy-2-(1,4-oxazepan-4-yl)aniline |
|---|---|
| PubChem CID | 63598726 |
| Molecular Formula | C12H17FN2O2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 5-fluoro-4-methoxy-2-(1,4-oxazepan-4-yl)aniline |
| SMILES | COc1cc(N2CCCOCC2)c(N)cc1F |
| InChI | InChI=1S/C12H17FN2O2/c1-16-12-8-11(10(14)7-9(12)13)15-3-2-5-17-6-4-15/h7-8H,2-6,14H2,1H3 |
| InChIKey | RNEGHIWQVURQFJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|