C18H32N2O7S — CID 3025701
2,5-dibutoxy-4-morpholin-4-ylaniline;sulfuric acid (PubChem CID 3025701) has the molecular formula C18H32N2O7S and a molecular weight of 420.53 g/mol. Its IUPAC name is 2,5-dibutoxy-4-morpholin-4-ylaniline;sulfuric acid.
| Compound Name | 2,5-dibutoxy-4-morpholin-4-ylaniline;sulfuric acid |
|---|---|
| PubChem CID | 3025701 |
| Molecular Formula | C18H32N2O7S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 2,5-dibutoxy-4-morpholin-4-ylaniline;sulfuric acid |
| SMILES | CCCCOc1cc(N2CCOCC2)c(OCCCC)cc1N.O=S(=O)(O)O |
| InChI | InChI=1S/C18H30N2O3.H2O4S/c1-3-5-9-22-17-14-16(20-7-11-21-12-8-20)18(13-15(17)19)23-10-6-4-2;1-5(2,3)4/h13-14H,3-12,19H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | ONLYZWBOMYPZPY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|