C27H38N4O5 — CID 76699827
methyl 2-[(2,5-dibutoxy-4-morpholin-4-ylphenyl)diazenyl]-2-(1-methyl-2-pyridinylidene)acetate (PubChem CID 76699827) has the molecular formula C27H38N4O5 and a molecular weight of 498.62 g/mol. Its IUPAC name is methyl 2-[(2,5-dibutoxy-4-morpholin-4-ylphenyl)diazenyl]-2-(1-methyl-2-pyridinylidene)acetate.
| Compound Name | methyl 2-[(2,5-dibutoxy-4-morpholin-4-ylphenyl)diazenyl]-2-(1-methyl-2-pyridinylidene)acetate |
|---|---|
| PubChem CID | 76699827 |
| Molecular Formula | C27H38N4O5 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | methyl 2-[(2,5-dibutoxy-4-morpholin-4-ylphenyl)diazenyl]-2-(1-methyl-2-pyridinylidene)acetate |
| SMILES | CCCCOc1cc(N2CCOCC2)c(OCCCC)cc1/N=N/C(C(=O)OC)=C1C=CC=CN1C |
| InChI | InChI=1S/C27H38N4O5/c1-5-7-15-35-24-20-23(31-13-17-34-18-14-31)25(36-16-8-6-2)19-21(24)28-29-26(27(32)33-4)22-11-9-10-12-30(22)3/h9-12,19-20H,5-8,13-18H2,1-4H3/b26-22?,29-28+ |
| InChIKey | HUUUAGQCGHICCG-UUTOMSJKSA-N |
| XLogP | 5.36 |
| TPSA | 85.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|