C16H19F2N3O5 — CID 165341106
methyl (Z)-2-[(2,5-difluoro-4-morpholin-4-ylphenyl)diazenyl]-3-hydroxy-4-methoxybut-2-enoate (PubChem CID 165341106) has the molecular formula C16H19F2N3O5 and a molecular weight of 371.34 g/mol. Its IUPAC name is methyl (Z)-2-[(2,5-difluoro-4-morpholin-4-ylphenyl)diazenyl]-3-hydroxy-4-methoxybut-2-enoate.
| Compound Name | methyl (Z)-2-[(2,5-difluoro-4-morpholin-4-ylphenyl)diazenyl]-3-hydroxy-4-methoxybut-2-enoate |
|---|---|
| PubChem CID | 165341106 |
| Molecular Formula | C16H19F2N3O5 |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | methyl (Z)-2-[(2,5-difluoro-4-morpholin-4-ylphenyl)diazenyl]-3-hydroxy-4-methoxybut-2-enoate |
| SMILES | COC/C(O)=C(/N=N/c1cc(F)c(N2CCOCC2)cc1F)C(=O)OC |
| InChI | InChI=1S/C16H19F2N3O5/c1-24-9-14(22)15(16(23)25-2)20-19-12-7-11(18)13(8-10(12)17)21-3-5-26-6-4-21/h7-8,22H,3-6,9H2,1-2H3/b15-14-,20-19+ |
| InChIKey | BXWOEVFYBHNFLY-UNGFROSVSA-N |
| XLogP | 2.47 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|