C19H22F2N4O5 — CID 90745425
1-(2,5-difluoro-4-morpholin-4-ylphenyl)-N,5-bis(methoxymethyl)-4-oxopyridazine-3-carboxamide (PubChem CID 90745425) has the molecular formula C19H22F2N4O5 and a molecular weight of 424.40 g/mol. Its IUPAC name is 1-(2,5-difluoro-4-morpholin-4-ylphenyl)-N,5-bis(methoxymethyl)-4-oxopyridazine-3-carboxamide.
| Compound Name | 1-(2,5-difluoro-4-morpholin-4-ylphenyl)-N,5-bis(methoxymethyl)-4-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 90745425 |
| Molecular Formula | C19H22F2N4O5 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 1-(2,5-difluoro-4-morpholin-4-ylphenyl)-N,5-bis(methoxymethyl)-4-oxopyridazine-3-carboxamide |
| SMILES | COCNC(=O)c1nn(-c2cc(F)c(N3CCOCC3)cc2F)cc(COC)c1=O |
| InChI | InChI=1S/C19H22F2N4O5/c1-28-10-12-9-25(23-17(18(12)26)19(27)22-11-29-2)16-8-13(20)15(7-14(16)21)24-3-5-30-6-4-24/h7-9H,3-6,10-11H2,1-2H3,(H,22,27) |
| InChIKey | UEYYHKXCDCESJB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|