C18H20F2N4O5 — CID 87562630
3-(2,5-difluoro-4-morpholin-4-ylphenyl)-N,4-dimethoxy-N-methyl-5-oxo-4H-pyridazine-6-carboxamide (PubChem CID 87562630) has the molecular formula C18H20F2N4O5 and a molecular weight of 410.38 g/mol. Its IUPAC name is 3-(2,5-difluoro-4-morpholin-4-ylphenyl)-N,4-dimethoxy-N-methyl-5-oxo-4H-pyridazine-6-carboxamide.
| Compound Name | 3-(2,5-difluoro-4-morpholin-4-ylphenyl)-N,4-dimethoxy-N-methyl-5-oxo-4H-pyridazine-6-carboxamide |
|---|---|
| PubChem CID | 87562630 |
| Molecular Formula | C18H20F2N4O5 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 3-(2,5-difluoro-4-morpholin-4-ylphenyl)-N,4-dimethoxy-N-methyl-5-oxo-4H-pyridazine-6-carboxamide |
| SMILES | COC1C(=O)C(C(=O)N(C)OC)=NN=C1c1cc(F)c(N2CCOCC2)cc1F |
| InChI | InChI=1S/C18H20F2N4O5/c1-23(28-3)18(26)15-16(25)17(27-2)14(21-22-15)10-8-12(20)13(9-11(10)19)24-4-6-29-7-5-24/h8-9,17H,4-7H2,1-3H3 |
| InChIKey | FBXMKPUOTCYCBX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 93.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|