C20H28FN3O7 — CID 171736036
tert-butyl N-(5-fluoro-4-morpholin-4-yl-2-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 171736036) has the molecular formula C20H28FN3O7 and a molecular weight of 441.46 g/mol. Its IUPAC name is tert-butyl N-(5-fluoro-4-morpholin-4-yl-2-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-(5-fluoro-4-morpholin-4-yl-2-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 171736036 |
| Molecular Formula | C20H28FN3O7 |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | tert-butyl N-(5-fluoro-4-morpholin-4-yl-2-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1cc(F)c(N2CCOCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H28FN3O7/c1-19(2,3)30-17(25)23(18(26)31-20(4,5)6)15-11-13(21)14(12-16(15)24(27)28)22-7-9-29-10-8-22/h11-12H,7-10H2,1-6H3 |
| InChIKey | WEZHLCPMMUGUOM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 111.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|