C30H42N6O10 — CID 160578093
tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-(4-morpholin-4-yl-2-nitrophenyl)carbamate;4-morpholin-4-yl-2-nitroaniline (PubChem CID 160578093) has the molecular formula C30H42N6O10 and a molecular weight of 646.70 g/mol. Its IUPAC name is tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-(4-morpholin-4-yl-2-nitrophenyl)carbamate;4-morpholin-4-yl-2-nitroaniline.
| Compound Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-(4-morpholin-4-yl-2-nitrophenyl)carbamate;4-morpholin-4-yl-2-nitroaniline |
|---|---|
| PubChem CID | 160578093 |
| Molecular Formula | C30H42N6O10 |
| Molecular Weight | 646.70 g/mol |
| Exact Mass | 646.30 |
| IUPAC Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-(4-morpholin-4-yl-2-nitrophenyl)carbamate;4-morpholin-4-yl-2-nitroaniline |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1ccc(N2CCOCC2)cc1[N+](=O)[O-].Nc1ccc(N2CCOCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H29N3O7.C10H13N3O3/c1-19(2,3)29-17(24)22(18(25)30-20(4,5)6)15-8-7-14(13-16(15)23(26)27)21-9-11-28-12-10-21;11-9-2-1-8(7-10(9)13(14)15)12-3-5-16-6-4-12/h7-8,13H,9-12H2,1-6H3;1-2,7H,3-6,11H2 |
| InChIKey | RBKKONBATLWXKM-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 193.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.70 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|