C15H14Cl2FNOS — CID 63594245
2-(2,5-dichlorophenyl)sulfanyl-5-fluoro-4-propoxyaniline (PubChem CID 63594245) has the molecular formula C15H14Cl2FNOS and a molecular weight of 346.25 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanyl-5-fluoro-4-propoxyaniline.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanyl-5-fluoro-4-propoxyaniline |
|---|---|
| PubChem CID | 63594245 |
| Molecular Formula | C15H14Cl2FNOS |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanyl-5-fluoro-4-propoxyaniline |
| SMILES | CCCOc1cc(Sc2cc(Cl)ccc2Cl)c(N)cc1F |
| InChI | InChI=1S/C15H14Cl2FNOS/c1-2-5-20-13-8-15(12(19)7-11(13)18)21-14-6-9(16)3-4-10(14)17/h3-4,6-8H,2,5,19H2,1H3 |
| InChIKey | XJHBQAMTLZINSM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|