C12H18FNO3S — CID 79682694
3-(2-amino-4-fluoro-5-propoxyphenyl)sulfanylpropane-1,2-diol (PubChem CID 79682694) has the molecular formula C12H18FNO3S and a molecular weight of 275.34 g/mol. Its IUPAC name is 3-(2-amino-4-fluoro-5-propoxyphenyl)sulfanylpropane-1,2-diol.
| Compound Name | 3-(2-amino-4-fluoro-5-propoxyphenyl)sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 79682694 |
| Molecular Formula | C12H18FNO3S |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 3-(2-amino-4-fluoro-5-propoxyphenyl)sulfanylpropane-1,2-diol |
| SMILES | CCCOc1cc(SCC(O)CO)c(N)cc1F |
| InChI | InChI=1S/C12H18FNO3S/c1-2-3-17-11-5-12(10(14)4-9(11)13)18-7-8(16)6-15/h4-5,8,15-16H,2-3,6-7,14H2,1H3 |
| InChIKey | CQOGGZRNQZBZCA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|