C25H36N3O3S+ — CID 59081663
[2,5-dibutoxy-4-[2-(diethylcarbamoyl)phenyl]sulfanylphenyl]iminoazanium (PubChem CID 59081663) has the molecular formula C25H36N3O3S+ and a molecular weight of 458.65 g/mol. Its IUPAC name is [2,5-dibutoxy-4-[2-(diethylcarbamoyl)phenyl]sulfanylphenyl]iminoazanium.
| Compound Name | [2,5-dibutoxy-4-[2-(diethylcarbamoyl)phenyl]sulfanylphenyl]iminoazanium |
|---|---|
| PubChem CID | 59081663 |
| Molecular Formula | C25H36N3O3S+ |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | [2,5-dibutoxy-4-[2-(diethylcarbamoyl)phenyl]sulfanylphenyl]iminoazanium |
| SMILES | CCCCOc1cc(Sc2ccccc2C(=O)N(CC)CC)c(OCCCC)cc1N=[NH2+] |
| InChI | InChI=1S/C25H35N3O3S/c1-5-9-15-30-21-18-24(22(17-20(21)27-26)31-16-10-6-2)32-23-14-12-11-13-19(23)25(29)28(7-3)8-4/h11-14,17-18,26H,5-10,15-16H2,1-4H3/p+1 |
| InChIKey | PDDAAOXSASYUMQ-UHFFFAOYSA-O |
| XLogP | 5.52 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|