C24H33F6N2O3PS — CID 19872352
2-(2,5-diethoxy-4-octoxyphenyl)-3-sulfanylbenzenediazonium hexafluorophosphate (PubChem CID 19872352) has the molecular formula C24H33F6N2O3PS and a molecular weight of 574.57 g/mol. Its IUPAC name is 2-(2,5-diethoxy-4-octoxyphenyl)-3-sulfanylbenzenediazonium hexafluorophosphate.
| Compound Name | 2-(2,5-diethoxy-4-octoxyphenyl)-3-sulfanylbenzenediazonium hexafluorophosphate |
|---|---|
| PubChem CID | 19872352 |
| Molecular Formula | C24H33F6N2O3PS |
| Molecular Weight | 574.57 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | 2-(2,5-diethoxy-4-octoxyphenyl)-3-sulfanylbenzenediazonium hexafluorophosphate |
| SMILES | CCCCCCCCOc1cc(OCC)c(-c2c(S)cccc2[N+]#N)cc1OCC.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C24H32N2O3S.F6P/c1-4-7-8-9-10-11-15-29-22-17-20(27-5-2)18(16-21(22)28-6-3)24-19(26-25)13-12-14-23(24)30;1-7(2,3,4,5)6/h12-14,16-17H,4-11,15H2,1-3H3;/q;-1/p+1 |
| InChIKey | UVGSKGIVDUDHKY-UHFFFAOYSA-O |
| XLogP | 11.05 |
| TPSA | 55.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.57 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|