C42H67F6N4P — CID 172867632
tris[4-(dibutylamino)phenyl]azanium hexafluorophosphate (PubChem CID 172867632) has the molecular formula C42H67F6N4P and a molecular weight of 772.99 g/mol. Its IUPAC name is tris[4-(dibutylamino)phenyl]azanium hexafluorophosphate.
| Compound Name | tris[4-(dibutylamino)phenyl]azanium hexafluorophosphate |
|---|---|
| PubChem CID | 172867632 |
| Molecular Formula | C42H67F6N4P |
| Molecular Weight | 772.99 g/mol |
| Exact Mass | 772.50 |
| IUPAC Name | tris[4-(dibutylamino)phenyl]azanium hexafluorophosphate |
| SMILES | CCCCN(CCCC)c1ccc([NH+](c2ccc(N(CCCC)CCCC)cc2)c2ccc(N(CCCC)CCCC)cc2)cc1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C42H66N4.F6P/c1-7-13-31-43(32-14-8-2)37-19-25-40(26-20-37)46(41-27-21-38(22-28-41)44(33-15-9-3)34-16-10-4)42-29-23-39(24-30-42)45(35-17-11-5)36-18-12-6;1-7(2,3,4,5)6/h19-30H,7-18,31-36H2,1-6H3;/q;-1/p+1 |
| InChIKey | RAXDQOJJGPUQMQ-UHFFFAOYSA-O |
| XLogP | 14.47 |
| TPSA | 14.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.99 |
| LogP ≤ 5 | 14.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|