C62H69N14+ — CID 21301840
[4-[4-[bis(3-cyanopropyl)amino]-N-[4-[bis(3-cyanopropyl)amino]phenyl]anilino]phenyl]-bis[4-[bis(3-cyanopropyl)amino]phenyl]azanium (PubChem CID 21301840) has the molecular formula C62H69N14+ and a molecular weight of 1010.33 g/mol. Its IUPAC name is [4-[4-[bis(3-cyanopropyl)amino]-N-[4-[bis(3-cyanopropyl)amino]phenyl]anilino]phenyl]-bis[4-[bis(3-cyanopropyl)amino]phenyl]azanium.
| Compound Name | [4-[4-[bis(3-cyanopropyl)amino]-N-[4-[bis(3-cyanopropyl)amino]phenyl]anilino]phenyl]-bis[4-[bis(3-cyanopropyl)amino]phenyl]azanium |
|---|---|
| PubChem CID | 21301840 |
| Molecular Formula | C62H69N14+ |
| Molecular Weight | 1010.33 g/mol |
| Exact Mass | 1009.58 |
| IUPAC Name | [4-[4-[bis(3-cyanopropyl)amino]-N-[4-[bis(3-cyanopropyl)amino]phenyl]anilino]phenyl]-bis[4-[bis(3-cyanopropyl)amino]phenyl]azanium |
| SMILES | N#CCCCN(CCCC#N)c1ccc(N(c2ccc(N(CCCC#N)CCCC#N)cc2)c2ccc([NH+](c3ccc(N(CCCC#N)CCCC#N)cc3)c3ccc(N(CCCC#N)CCCC#N)cc3)cc2)cc1 |
| InChI | InChI=1S/C62H68N14/c63-37-1-9-45-71(46-10-2-38-64)53-17-25-57(26-18-53)75(58-27-19-54(20-28-58)72(47-11-3-39-65)48-12-4-40-66)61-33-35-62(36-34-61)76(59-29-21-55(22-30-59)73(49-13-5-41-67)50-14-6-42-68)60-31-23-56(24-32-60)74(51-15-7-43-69)52-16-8-44-70/h17-36H,1-16,45-52H2/p+1 |
| InChIKey | YYPSDIXFDFZKNQ-UHFFFAOYSA-O |
| XLogP | 12.99 |
| TPSA | 210.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1010.33 |
| LogP ≤ 5 | 12.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|