C23H33N2O4+ — CID 100798652
[(2R)-3-(2-tert-butyl-4-methylphenoxy)-2-hydroxypropyl]-dimethyl-[(4-nitrophenyl)methyl]azanium (PubChem CID 100798652) has the molecular formula C23H33N2O4+ and a molecular weight of 401.53 g/mol. Its IUPAC name is [(2R)-3-(2-tert-butyl-4-methylphenoxy)-2-hydroxypropyl]-dimethyl-[(4-nitrophenyl)methyl]azanium.
| Compound Name | [(2R)-3-(2-tert-butyl-4-methylphenoxy)-2-hydroxypropyl]-dimethyl-[(4-nitrophenyl)methyl]azanium |
|---|---|
| PubChem CID | 100798652 |
| Molecular Formula | C23H33N2O4+ |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | [(2R)-3-(2-tert-butyl-4-methylphenoxy)-2-hydroxypropyl]-dimethyl-[(4-nitrophenyl)methyl]azanium |
| SMILES | Cc1ccc(OC[C@H](O)C[N+](C)(C)Cc2ccc([N+](=O)[O-])cc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H33N2O4/c1-17-7-12-22(21(13-17)23(2,3)4)29-16-20(26)15-25(5,6)14-18-8-10-19(11-9-18)24(27)28/h7-13,20,26H,14-16H2,1-6H3/q+1/t20-/m1/s1 |
| InChIKey | WHHPKWXLMQLYGN-HXUWFJFHSA-N |
| XLogP | 4.22 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|