About 1-(benzylamino)-3-phenoxypropan-2-ol;ethane;methyl 2-methoxyacetate
1-(benzylamino)-3-phenoxypropan-2-ol;ethane;methyl 2-methoxyacetate (PubChem CID 91403066) has the molecular formula C22H33NO5
and a molecular weight of 391.51 g/mol. Its IUPAC name is 1-(benzylamino)-3-phenoxypropan-2-ol;ethane;methyl 2-methoxyacetate.
Molecular Properties
| Compound Name | 1-(benzylamino)-3-phenoxypropan-2-ol;ethane;methyl 2-methoxyacetate |
| PubChem CID | 91403066 |
| Molecular Formula | C22H33NO5 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | 1-(benzylamino)-3-phenoxypropan-2-ol;ethane;methyl 2-methoxyacetate |
| SMILES | CC.COCC(=O)OC.OC(CNCc1ccccc1)COc1ccccc1 |
| InChI | InChI=1S/C16H19NO2.C4H8O3.C2H6/c18-15(13-19-16-9-5-2-6-10-16)12-17-11-14-7-3-1-4-8-14;1-6-3-4(5)7-2;1-2/h1-10,15,17-18H,11-13H2;3H2,1-2H3;1-2H3 |
| InChIKey | HREBGDPSOREYOD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(benzylamino)-3-phenoxypropan-2-ol;ethane;methyl 2-methoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzylamino)-3-phenoxypropan-2-ol;ethane;methyl 2-methoxyacetate?
The IUPAC name of 1-(benzylamino)-3-phenoxypropan-2-ol;ethane;methyl 2-methoxyacetate (CID 91403066) is 1-(benzylamino)-3-phenoxypropan-2-ol;ethane;methyl 2-methoxyacetate.
What is the SMILES notation for 1-(benzylamino)-3-phenoxypropan-2-ol;ethane;methyl 2-methoxyacetate?
The canonical SMILES for 1-(benzylamino)-3-phenoxypropan-2-ol;ethane;methyl 2-methoxyacetate is CC.COCC(=O)OC.OC(CNCc1ccccc1)COc1ccccc1.
What is the InChIKey of 1-(benzylamino)-3-phenoxypropan-2-ol;ethane;methyl 2-methoxyacetate?
The InChIKey is HREBGDPSOREYOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2.C4H8O3.C2H6/c18-15(13-19-16-9-5-2-6-10-16)12-17-11-14-7-3-1-4-8-14;1-6-3-4(5)7-2;1-2/h1-10,15,17-18H,11-13H2;3H2,1-2H3;1-2H3.
What are the key properties of 1-(benzylamino)-3-phenoxypropan-2-ol;ethane;methyl 2-methoxyacetate?
1-(benzylamino)-3-phenoxypropan-2-ol;ethane;methyl 2-methoxyacetate has a molecular weight of 391.51 g/mol, XLogP of 3.05, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzylamino)-3-phenoxypropan-2-ol;ethane;methyl 2-methoxyacetate is sourced from PubChem (CID 91403066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).