C26H27NO4 — CID 68773263
methyl 3-[4-[3-(benzylamino)-2-hydroxypropoxy]phenyl]-2-phenylprop-2-enoate (PubChem CID 68773263) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is methyl 3-[4-[3-(benzylamino)-2-hydroxypropoxy]phenyl]-2-phenylprop-2-enoate.
| Compound Name | methyl 3-[4-[3-(benzylamino)-2-hydroxypropoxy]phenyl]-2-phenylprop-2-enoate |
|---|---|
| PubChem CID | 68773263 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | methyl 3-[4-[3-(benzylamino)-2-hydroxypropoxy]phenyl]-2-phenylprop-2-enoate |
| SMILES | COC(=O)C(=Cc1ccc(OCC(O)CNCc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H27NO4/c1-30-26(29)25(22-10-6-3-7-11-22)16-20-12-14-24(15-13-20)31-19-23(28)18-27-17-21-8-4-2-5-9-21/h2-16,23,27-28H,17-19H2,1H3 |
| InChIKey | BEFOZDKHHFNUQB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|