C30H33F2NO8 — CID 42606027
methyl (E)-2-[4-[3-[[4-(difluoromethoxy)phenyl]methylamino]-2-hydroxypropoxy]phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 42606027) has the molecular formula C30H33F2NO8 and a molecular weight of 573.59 g/mol. Its IUPAC name is methyl (E)-2-[4-[3-[[4-(difluoromethoxy)phenyl]methylamino]-2-hydroxypropoxy]phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | methyl (E)-2-[4-[3-[[4-(difluoromethoxy)phenyl]methylamino]-2-hydroxypropoxy]phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 42606027 |
| Molecular Formula | C30H33F2NO8 |
| Molecular Weight | 573.59 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | methyl (E)-2-[4-[3-[[4-(difluoromethoxy)phenyl]methylamino]-2-hydroxypropoxy]phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COC(=O)/C(=C/c1cc(OC)c(OC)c(OC)c1)c1ccc(OCC(O)CNCc2ccc(OC(F)F)cc2)cc1 |
| InChI | InChI=1S/C30H33F2NO8/c1-36-26-14-20(15-27(37-2)28(26)38-3)13-25(29(35)39-4)21-7-11-23(12-8-21)40-18-22(34)17-33-16-19-5-9-24(10-6-19)41-30(31)32/h5-15,22,30,33-34H,16-18H2,1-4H3/b25-13+ |
| InChIKey | SBDAZPXDDBLSRL-DHRITJCHSA-N |
| XLogP | 4.56 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|