C27H31NO6S — CID 68774984
methyl 2-[4-[2-hydroxy-3-[1-(2-methoxyphenoxy)ethylamino]propoxy]phenyl]-3-(5-methylthiophen-2-yl)prop-2-enoate (PubChem CID 68774984) has the molecular formula C27H31NO6S and a molecular weight of 497.61 g/mol. Its IUPAC name is methyl 2-[4-[2-hydroxy-3-[1-(2-methoxyphenoxy)ethylamino]propoxy]phenyl]-3-(5-methylthiophen-2-yl)prop-2-enoate.
| Compound Name | methyl 2-[4-[2-hydroxy-3-[1-(2-methoxyphenoxy)ethylamino]propoxy]phenyl]-3-(5-methylthiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 68774984 |
| Molecular Formula | C27H31NO6S |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | methyl 2-[4-[2-hydroxy-3-[1-(2-methoxyphenoxy)ethylamino]propoxy]phenyl]-3-(5-methylthiophen-2-yl)prop-2-enoate |
| SMILES | COC(=O)C(=Cc1ccc(C)s1)c1ccc(OCC(O)CNC(C)Oc2ccccc2OC)cc1 |
| InChI | InChI=1S/C27H31NO6S/c1-18-9-14-23(35-18)15-24(27(30)32-4)20-10-12-22(13-11-20)33-17-21(29)16-28-19(2)34-26-8-6-5-7-25(26)31-3/h5-15,19,21,28-29H,16-17H2,1-4H3 |
| InChIKey | WFOXULUHVFTGSR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|