C30H35NO8 — CID 42606490
methyl (E)-3-(3,4-dimethoxyphenyl)-2-[4-[2-hydroxy-3-[2-methoxyethyl(phenoxy)amino]propoxy]phenyl]prop-2-enoate (PubChem CID 42606490) has the molecular formula C30H35NO8 and a molecular weight of 537.61 g/mol. Its IUPAC name is methyl (E)-3-(3,4-dimethoxyphenyl)-2-[4-[2-hydroxy-3-[2-methoxyethyl(phenoxy)amino]propoxy]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-(3,4-dimethoxyphenyl)-2-[4-[2-hydroxy-3-[2-methoxyethyl(phenoxy)amino]propoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 42606490 |
| Molecular Formula | C30H35NO8 |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | methyl (E)-3-(3,4-dimethoxyphenyl)-2-[4-[2-hydroxy-3-[2-methoxyethyl(phenoxy)amino]propoxy]phenyl]prop-2-enoate |
| SMILES | COCCN(CC(O)COc1ccc(/C(=C\c2ccc(OC)c(OC)c2)C(=O)OC)cc1)Oc1ccccc1 |
| InChI | InChI=1S/C30H35NO8/c1-34-17-16-31(39-26-8-6-5-7-9-26)20-24(32)21-38-25-13-11-23(12-14-25)27(30(33)37-4)18-22-10-15-28(35-2)29(19-22)36-3/h5-15,18-19,24,32H,16-17,20-21H2,1-4H3/b27-18+ |
| InChIKey | XOGWTFIGKQHELS-OVVQPSECSA-N |
| XLogP | 4.10 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|