C28H31NO6 — CID 68772979
methyl (Z)-2-[4-[3-[(2,4-dimethoxyphenyl)methylamino]-2-hydroxypropoxy]phenyl]-3-phenylprop-2-enoate (PubChem CID 68772979) has the molecular formula C28H31NO6 and a molecular weight of 477.56 g/mol. Its IUPAC name is methyl (Z)-2-[4-[3-[(2,4-dimethoxyphenyl)methylamino]-2-hydroxypropoxy]phenyl]-3-phenylprop-2-enoate.
| Compound Name | methyl (Z)-2-[4-[3-[(2,4-dimethoxyphenyl)methylamino]-2-hydroxypropoxy]phenyl]-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 68772979 |
| Molecular Formula | C28H31NO6 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | methyl (Z)-2-[4-[3-[(2,4-dimethoxyphenyl)methylamino]-2-hydroxypropoxy]phenyl]-3-phenylprop-2-enoate |
| SMILES | COC(=O)/C(=C\c1ccccc1)c1ccc(OCC(O)CNCc2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C28H31NO6/c1-32-25-14-11-22(27(16-25)33-2)17-29-18-23(30)19-35-24-12-9-21(10-13-24)26(28(31)34-3)15-20-7-5-4-6-8-20/h4-16,23,29-30H,17-19H2,1-3H3/b26-15- |
| InChIKey | VGNYNEDONLSTEI-YSMPRRRNSA-N |
| XLogP | 3.95 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|