C14H23NO4 — CID 63931950
1-[(2,4-dimethoxyphenyl)methylamino]-3-ethoxypropan-2-ol (PubChem CID 63931950) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methylamino]-3-ethoxypropan-2-ol.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methylamino]-3-ethoxypropan-2-ol |
|---|---|
| PubChem CID | 63931950 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methylamino]-3-ethoxypropan-2-ol |
| SMILES | CCOCC(O)CNCc1ccc(OC)cc1OC |
| InChI | InChI=1S/C14H23NO4/c1-4-19-10-12(16)9-15-8-11-5-6-13(17-2)7-14(11)18-3/h5-7,12,15-16H,4,8-10H2,1-3H3 |
| InChIKey | BUIXMKGJHVIVPO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |