C12H20N2O3 — CID 63933376
1-ethoxy-3-[(2-methoxy-3-pyridinyl)methylamino]propan-2-ol (PubChem CID 63933376) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 1-ethoxy-3-[(2-methoxy-3-pyridinyl)methylamino]propan-2-ol.
| Compound Name | 1-ethoxy-3-[(2-methoxy-3-pyridinyl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 63933376 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 1-ethoxy-3-[(2-methoxy-3-pyridinyl)methylamino]propan-2-ol |
| SMILES | CCOCC(O)CNCc1cccnc1OC |
| InChI | InChI=1S/C12H20N2O3/c1-3-17-9-11(15)8-13-7-10-5-4-6-14-12(10)16-2/h4-6,11,13,15H,3,7-9H2,1-2H3 |
| InChIKey | MPPFQXSRRRAQND-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |