C10H16N2O2 — CID 106931879
(2S)-1-[(2-methoxy-3-pyridinyl)methylamino]propan-2-ol (PubChem CID 106931879) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is (2S)-1-[(2-methoxy-3-pyridinyl)methylamino]propan-2-ol.
| Compound Name | (2S)-1-[(2-methoxy-3-pyridinyl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 106931879 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | (2S)-1-[(2-methoxy-3-pyridinyl)methylamino]propan-2-ol |
| SMILES | COc1ncccc1CNC[C@H](C)O |
| InChI | InChI=1S/C10H16N2O2/c1-8(13)6-11-7-9-4-3-5-12-10(9)14-2/h3-5,8,11,13H,6-7H2,1-2H3/t8-/m0/s1 |
| InChIKey | ORRHYEUHCBZDLP-QMMMGPOBSA-N |
| XLogP | 0.56 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |