C28H30FNO6 — CID 68772139
methyl 2-(3-fluorophenyl)-3-[4-[2-hydroxy-3-[1-(2-methoxyphenoxy)ethylamino]propoxy]phenyl]prop-2-enoate (PubChem CID 68772139) has the molecular formula C28H30FNO6 and a molecular weight of 495.55 g/mol. Its IUPAC name is methyl 2-(3-fluorophenyl)-3-[4-[2-hydroxy-3-[1-(2-methoxyphenoxy)ethylamino]propoxy]phenyl]prop-2-enoate.
| Compound Name | methyl 2-(3-fluorophenyl)-3-[4-[2-hydroxy-3-[1-(2-methoxyphenoxy)ethylamino]propoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 68772139 |
| Molecular Formula | C28H30FNO6 |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | methyl 2-(3-fluorophenyl)-3-[4-[2-hydroxy-3-[1-(2-methoxyphenoxy)ethylamino]propoxy]phenyl]prop-2-enoate |
| SMILES | COC(=O)C(=Cc1ccc(OCC(O)CNC(C)Oc2ccccc2OC)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C28H30FNO6/c1-19(36-27-10-5-4-9-26(27)33-2)30-17-23(31)18-35-24-13-11-20(12-14-24)15-25(28(32)34-3)21-7-6-8-22(29)16-21/h4-16,19,23,30-31H,17-18H2,1-3H3 |
| InChIKey | CJRLASAFNQWFJF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|