C29H30F3NO7 — CID 68772093
methyl 3-(3,5-dimethoxyphenyl)-2-[4-[2-hydroxy-3-[[4-(trifluoromethoxy)phenyl]methylamino]propoxy]phenyl]prop-2-enoate (PubChem CID 68772093) has the molecular formula C29H30F3NO7 and a molecular weight of 561.55 g/mol. Its IUPAC name is methyl 3-(3,5-dimethoxyphenyl)-2-[4-[2-hydroxy-3-[[4-(trifluoromethoxy)phenyl]methylamino]propoxy]phenyl]prop-2-enoate.
| Compound Name | methyl 3-(3,5-dimethoxyphenyl)-2-[4-[2-hydroxy-3-[[4-(trifluoromethoxy)phenyl]methylamino]propoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 68772093 |
| Molecular Formula | C29H30F3NO7 |
| Molecular Weight | 561.55 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | methyl 3-(3,5-dimethoxyphenyl)-2-[4-[2-hydroxy-3-[[4-(trifluoromethoxy)phenyl]methylamino]propoxy]phenyl]prop-2-enoate |
| SMILES | COC(=O)C(=Cc1cc(OC)cc(OC)c1)c1ccc(OCC(O)CNCc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C29H30F3NO7/c1-36-25-12-20(13-26(15-25)37-2)14-27(28(35)38-3)21-6-10-23(11-7-21)39-18-22(34)17-33-16-19-4-8-24(9-5-19)40-29(30,31)32/h4-15,22,33-34H,16-18H2,1-3H3 |
| InChIKey | LCKUCTGDIAFGIG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|