C29H32FNO7 — CID 68771070
methyl 3-(4-fluoro-3-methoxyphenyl)-2-[4-[2-hydroxy-3-[(2-methoxy-2-phenoxyethyl)amino]propoxy]phenyl]prop-2-enoate (PubChem CID 68771070) has the molecular formula C29H32FNO7 and a molecular weight of 525.57 g/mol. Its IUPAC name is methyl 3-(4-fluoro-3-methoxyphenyl)-2-[4-[2-hydroxy-3-[(2-methoxy-2-phenoxyethyl)amino]propoxy]phenyl]prop-2-enoate.
| Compound Name | methyl 3-(4-fluoro-3-methoxyphenyl)-2-[4-[2-hydroxy-3-[(2-methoxy-2-phenoxyethyl)amino]propoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 68771070 |
| Molecular Formula | C29H32FNO7 |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | methyl 3-(4-fluoro-3-methoxyphenyl)-2-[4-[2-hydroxy-3-[(2-methoxy-2-phenoxyethyl)amino]propoxy]phenyl]prop-2-enoate |
| SMILES | COC(=O)C(=Cc1ccc(F)c(OC)c1)c1ccc(OCC(O)CNCC(OC)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C29H32FNO7/c1-34-27-16-20(9-14-26(27)30)15-25(29(33)36-3)21-10-12-23(13-11-21)37-19-22(32)17-31-18-28(35-2)38-24-7-5-4-6-8-24/h4-16,22,28,31-32H,17-19H2,1-3H3 |
| InChIKey | YTFCVOVWEWLWHG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|