C29H33NO6S — CID 25265393
methyl (E)-2-[4-[3-[(2,4-dimethoxyphenyl)methylamino]-2-hydroxypropoxy]phenyl]-3-(4-methylsulfanylphenyl)prop-2-enoate (PubChem CID 25265393) has the molecular formula C29H33NO6S and a molecular weight of 523.65 g/mol. Its IUPAC name is methyl (E)-2-[4-[3-[(2,4-dimethoxyphenyl)methylamino]-2-hydroxypropoxy]phenyl]-3-(4-methylsulfanylphenyl)prop-2-enoate.
| Compound Name | methyl (E)-2-[4-[3-[(2,4-dimethoxyphenyl)methylamino]-2-hydroxypropoxy]phenyl]-3-(4-methylsulfanylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 25265393 |
| Molecular Formula | C29H33NO6S |
| Molecular Weight | 523.65 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | methyl (E)-2-[4-[3-[(2,4-dimethoxyphenyl)methylamino]-2-hydroxypropoxy]phenyl]-3-(4-methylsulfanylphenyl)prop-2-enoate |
| SMILES | COC(=O)/C(=C/c1ccc(SC)cc1)c1ccc(OCC(O)CNCc2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C29H33NO6S/c1-33-25-12-9-22(28(16-25)34-2)17-30-18-23(31)19-36-24-10-7-21(8-11-24)27(29(32)35-3)15-20-5-13-26(37-4)14-6-20/h5-16,23,30-31H,17-19H2,1-4H3/b27-15+ |
| InChIKey | KJQVUXLAEKZGHP-JFLMPSFJSA-N |
| XLogP | 4.67 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.65 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|