C29H34N2O7 — CID 68774808
3-(2,4-dimethoxyphenyl)-2-[4-[2-hydroxy-3-[(2-methoxy-2-phenoxyethyl)amino]propoxy]phenyl]prop-2-enamide (PubChem CID 68774808) has the molecular formula C29H34N2O7 and a molecular weight of 522.60 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-2-[4-[2-hydroxy-3-[(2-methoxy-2-phenoxyethyl)amino]propoxy]phenyl]prop-2-enamide.
| Compound Name | 3-(2,4-dimethoxyphenyl)-2-[4-[2-hydroxy-3-[(2-methoxy-2-phenoxyethyl)amino]propoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 68774808 |
| Molecular Formula | C29H34N2O7 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-2-[4-[2-hydroxy-3-[(2-methoxy-2-phenoxyethyl)amino]propoxy]phenyl]prop-2-enamide |
| SMILES | COc1ccc(C=C(C(N)=O)c2ccc(OCC(O)CNCC(OC)Oc3ccccc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C29H34N2O7/c1-34-25-14-11-21(27(16-25)35-2)15-26(29(30)33)20-9-12-23(13-10-20)37-19-22(32)17-31-18-28(36-3)38-24-7-5-4-6-8-24/h4-16,22,28,31-32H,17-19H2,1-3H3,(H2,30,33) |
| InChIKey | AJJCJBVXTHLDBY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|