C21H25NO5 — CID 22682522
(Z)-2-(3,4-dimethoxyphenyl)-3-[3-[2-(dimethylamino)ethoxy]phenyl]prop-2-enoic acid (PubChem CID 22682522) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is (Z)-2-(3,4-dimethoxyphenyl)-3-[3-[2-(dimethylamino)ethoxy]phenyl]prop-2-enoic acid.
| Compound Name | (Z)-2-(3,4-dimethoxyphenyl)-3-[3-[2-(dimethylamino)ethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22682522 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (Z)-2-(3,4-dimethoxyphenyl)-3-[3-[2-(dimethylamino)ethoxy]phenyl]prop-2-enoic acid |
| SMILES | COc1ccc(/C(=C/c2cccc(OCCN(C)C)c2)C(=O)O)cc1OC |
| InChI | InChI=1S/C21H25NO5/c1-22(2)10-11-27-17-7-5-6-15(12-17)13-18(21(23)24)16-8-9-19(25-3)20(14-16)26-4/h5-9,12-14H,10-11H2,1-4H3,(H,23,24)/b18-13- |
| InChIKey | ADCDKWMMUVBTHO-AQTBWJFISA-N |
| XLogP | 3.27 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|