C21H27N3O5 — CID 88795408
4-[2-[[2-hydroxy-3-[3-(hydroxyiminomethyl)-2-methylphenoxy]propyl]amino]propoxy]benzamide (PubChem CID 88795408) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is 4-[2-[[2-hydroxy-3-[3-(hydroxyiminomethyl)-2-methylphenoxy]propyl]amino]propoxy]benzamide.
| Compound Name | 4-[2-[[2-hydroxy-3-[3-(hydroxyiminomethyl)-2-methylphenoxy]propyl]amino]propoxy]benzamide |
|---|---|
| PubChem CID | 88795408 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 4-[2-[[2-hydroxy-3-[3-(hydroxyiminomethyl)-2-methylphenoxy]propyl]amino]propoxy]benzamide |
| SMILES | Cc1c(C=NO)cccc1OCC(O)CNC(C)COc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C21H27N3O5/c1-14(12-28-19-8-6-16(7-9-19)21(22)26)23-11-18(25)13-29-20-5-3-4-17(10-24-27)15(20)2/h3-10,14,18,23,25,27H,11-13H2,1-2H3,(H2,22,26) |
| InChIKey | JULXXNDKXICFEH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|