C19H25N2O4+ — CID 24848295
2-(4-carbamoylphenoxy)ethyl-[2-hydroxy-3-(2-methylphenoxy)propyl]azanium (PubChem CID 24848295) has the molecular formula C19H25N2O4+ and a molecular weight of 345.42 g/mol. Its IUPAC name is 2-(4-carbamoylphenoxy)ethyl-[2-hydroxy-3-(2-methylphenoxy)propyl]azanium.
| Compound Name | 2-(4-carbamoylphenoxy)ethyl-[2-hydroxy-3-(2-methylphenoxy)propyl]azanium |
|---|---|
| PubChem CID | 24848295 |
| Molecular Formula | C19H25N2O4+ |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 2-(4-carbamoylphenoxy)ethyl-[2-hydroxy-3-(2-methylphenoxy)propyl]azanium |
| SMILES | Cc1ccccc1OCC(O)C[NH2+]CCOc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C19H24N2O4/c1-14-4-2-3-5-18(14)25-13-16(22)12-21-10-11-24-17-8-6-15(7-9-17)19(20)23/h2-9,16,21-22H,10-13H2,1H3,(H2,20,23)/p+1 |
| InChIKey | SKQDKFOTIPJUSV-UHFFFAOYSA-O |
| XLogP | 0.48 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|