C19H26N2O — CID 170894728
1-(5-tert-butyl-2-phenylmethoxyphenyl)ethane-1,2-diamine (PubChem CID 170894728) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-(5-tert-butyl-2-phenylmethoxyphenyl)ethane-1,2-diamine.
| Compound Name | 1-(5-tert-butyl-2-phenylmethoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 170894728 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 1-(5-tert-butyl-2-phenylmethoxyphenyl)ethane-1,2-diamine |
| SMILES | CC(C)(C)c1ccc(OCc2ccccc2)c(C(N)CN)c1 |
| InChI | InChI=1S/C19H26N2O/c1-19(2,3)15-9-10-18(16(11-15)17(21)12-20)22-13-14-7-5-4-6-8-14/h4-11,17H,12-13,20-21H2,1-3H3 |
| InChIKey | UXASQWGXWSDDIR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |