C15H14BrNO — CID 98749698
(2R)-2-bromo-1-(3,5-dimethylphenyl)-2-pyridin-4-ylethanone (PubChem CID 98749698) has the molecular formula C15H14BrNO and a molecular weight of 304.19 g/mol. Its IUPAC name is (2R)-2-bromo-1-(3,5-dimethylphenyl)-2-pyridin-4-ylethanone.
| Compound Name | (2R)-2-bromo-1-(3,5-dimethylphenyl)-2-pyridin-4-ylethanone |
|---|---|
| PubChem CID | 98749698 |
| Molecular Formula | C15H14BrNO |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | (2R)-2-bromo-1-(3,5-dimethylphenyl)-2-pyridin-4-ylethanone |
| SMILES | Cc1cc(C)cc(C(=O)[C@H](Br)c2ccncc2)c1 |
| InChI | InChI=1S/C15H14BrNO/c1-10-7-11(2)9-13(8-10)15(18)14(16)12-3-5-17-6-4-12/h3-9,14H,1-2H3/t14-/m1/s1 |
| InChIKey | APBLTHAVGMLRGP-CQSZACIVSA-N |
| XLogP | 4.02 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|