C20H23BrN2O3 — CID 99646792
tert-butyl N-[4-[(1R)-1-bromo-2-(3,5-dimethylphenyl)-2-oxoethyl]-2-pyridinyl]carbamate (PubChem CID 99646792) has the molecular formula C20H23BrN2O3 and a molecular weight of 419.32 g/mol. Its IUPAC name is tert-butyl N-[4-[(1R)-1-bromo-2-(3,5-dimethylphenyl)-2-oxoethyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[4-[(1R)-1-bromo-2-(3,5-dimethylphenyl)-2-oxoethyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 99646792 |
| Molecular Formula | C20H23BrN2O3 |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | tert-butyl N-[4-[(1R)-1-bromo-2-(3,5-dimethylphenyl)-2-oxoethyl]-2-pyridinyl]carbamate |
| SMILES | Cc1cc(C)cc(C(=O)[C@H](Br)c2ccnc(NC(=O)OC(C)(C)C)c2)c1 |
| InChI | InChI=1S/C20H23BrN2O3/c1-12-8-13(2)10-15(9-12)18(24)17(21)14-6-7-22-16(11-14)23-19(25)26-20(3,4)5/h6-11,17H,1-5H3,(H,22,23,25)/t17-/m1/s1 |
| InChIKey | OHBFEXWAUNRFJV-QGZVFWFLSA-N |
| XLogP | 5.36 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|